C18H23NO2S2 — CID 7668349
(2Z)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-(4-methylphenyl)sulfanylethyl]-1,3-thiazolidin-4-one (PubChem CID 7668349) has the molecular formula C18H23NO2S2 and a molecular weight of 349.52 g/mol. Its IUPAC name is (2Z)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-(4-methylphenyl)sulfanylethyl]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-(4-methylphenyl)sulfanylethyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 7668349 |
| Molecular Formula | C18H23NO2S2 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (2Z)-2-(3,3-dimethyl-2-oxobutylidene)-3-[2-(4-methylphenyl)sulfanylethyl]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(SCCN2C(=O)CS/C2=C\C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H23NO2S2/c1-13-5-7-14(8-6-13)22-10-9-19-16(21)12-23-17(19)11-15(20)18(2,3)4/h5-8,11H,9-10,12H2,1-4H3/b17-11- |
| InChIKey | COIMSKHSVLQAPY-BOPFTXTBSA-N |
| XLogP | 4.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|