C16H19NO4S2 — CID 9063402
ethyl (2Z)-2-[3-[2-(4-methoxyphenyl)sulfanylethyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate (PubChem CID 9063402) has the molecular formula C16H19NO4S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is ethyl (2Z)-2-[3-[2-(4-methoxyphenyl)sulfanylethyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[3-[2-(4-methoxyphenyl)sulfanylethyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 9063402 |
| Molecular Formula | C16H19NO4S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | ethyl (2Z)-2-[3-[2-(4-methoxyphenyl)sulfanylethyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\SCC(=O)N1CCSc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H19NO4S2/c1-3-21-16(19)10-15-17(14(18)11-23-15)8-9-22-13-6-4-12(20-2)5-7-13/h4-7,10H,3,8-9,11H2,1-2H3/b15-10- |
| InChIKey | WOIVZHYVZATZPD-GDNBJRDFSA-N |
| XLogP | 2.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|