C16H17N3O3S2 — CID 17464071
ethyl (2Z)-2-[3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetate (PubChem CID 17464071) has the molecular formula C16H17N3O3S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is ethyl (2Z)-2-[3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 17464071 |
| Molecular Formula | C16H17N3O3S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | ethyl (2Z)-2-[3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\SCC(=O)N1CCSc1ncc2ccccn12 |
| InChI | InChI=1S/C16H17N3O3S2/c1-2-22-15(21)9-14-19(13(20)11-24-14)7-8-23-16-17-10-12-5-3-4-6-18(12)16/h3-6,9-10H,2,7-8,11H2,1H3/b14-9- |
| InChIKey | QRJICGXCPOREPB-ZROIWOOFSA-N |
| XLogP | 2.41 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|