C16H17N5O3S2 — CID 7503851
ethyl (2Z)-2-[4-oxo-3-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]-1,3-thiazolidin-2-ylidene]acetate (PubChem CID 7503851) has the molecular formula C16H17N5O3S2 and a molecular weight of 391.48 g/mol. Its IUPAC name is ethyl (2Z)-2-[4-oxo-3-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]-1,3-thiazolidin-2-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[4-oxo-3-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]-1,3-thiazolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 7503851 |
| Molecular Formula | C16H17N5O3S2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | ethyl (2Z)-2-[4-oxo-3-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]-1,3-thiazolidin-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\SCC(=O)N1CCSc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C16H17N5O3S2/c1-2-24-15(23)10-14-20(13(22)11-26-14)8-9-25-16-17-18-19-21(16)12-6-4-3-5-7-12/h3-7,10H,2,8-9,11H2,1H3/b14-10- |
| InChIKey | OQPUFZFYDWVUNK-UVTDQMKNSA-N |
| XLogP | 1.73 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|