C22H30N4O5S — CID 159006993
ethyl (E)-3-methyl-5-(1-phenyltetrazol-5-yl)sulfanylpent-2-enoate;methyl (E)-5-hydroxy-3-methylpent-2-enoate (PubChem CID 159006993) has the molecular formula C22H30N4O5S and a molecular weight of 462.57 g/mol. Its IUPAC name is ethyl (E)-3-methyl-5-(1-phenyltetrazol-5-yl)sulfanylpent-2-enoate;methyl (E)-5-hydroxy-3-methylpent-2-enoate.
| Compound Name | ethyl (E)-3-methyl-5-(1-phenyltetrazol-5-yl)sulfanylpent-2-enoate;methyl (E)-5-hydroxy-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 159006993 |
| Molecular Formula | C22H30N4O5S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | ethyl (E)-3-methyl-5-(1-phenyltetrazol-5-yl)sulfanylpent-2-enoate;methyl (E)-5-hydroxy-3-methylpent-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)CCSc1nnnn1-c1ccccc1.COC(=O)/C=C(\C)CCO |
| InChI | InChI=1S/C15H18N4O2S.C7H12O3/c1-3-21-14(20)11-12(2)9-10-22-15-16-17-18-19(15)13-7-5-4-6-8-13;1-6(3-4-8)5-7(9)10-2/h4-8,11H,3,9-10H2,1-2H3;5,8H,3-4H2,1-2H3/b12-11+;6-5+ |
| InChIKey | JSAUODRDRFXTQK-YASANWAOSA-N |
| XLogP | 3.14 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|