C16H20N4O3S — CID 71762755
methyl [(E)-7-(1-phenyltetrazol-5-yl)sulfanylhept-2-enyl] carbonate (PubChem CID 71762755) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is methyl [(E)-7-(1-phenyltetrazol-5-yl)sulfanylhept-2-enyl] carbonate.
| Compound Name | methyl [(E)-7-(1-phenyltetrazol-5-yl)sulfanylhept-2-enyl] carbonate |
|---|---|
| PubChem CID | 71762755 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | methyl [(E)-7-(1-phenyltetrazol-5-yl)sulfanylhept-2-enyl] carbonate |
| SMILES | COC(=O)OC/C=C/CCCCSc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C16H20N4O3S/c1-22-16(21)23-12-8-3-2-4-9-13-24-15-17-18-19-20(15)14-10-6-5-7-11-14/h3,5-8,10-11H,2,4,9,12-13H2,1H3/b8-3+ |
| InChIKey | QOFCPJLMYFALDR-FPYGCLRLSA-N |
| XLogP | 3.26 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|