C10H11NO4 — CID 77076179
4-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylbut-2-enoic acid (PubChem CID 77076179) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is 4-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylbut-2-enoic acid.
| Compound Name | 4-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 77076179 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 4-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylbut-2-enoic acid |
| SMILES | CC(=CCN1C(=O)C2CC2C1=O)C(=O)O |
| InChI | InChI=1S/C10H11NO4/c1-5(10(14)15)2-3-11-8(12)6-4-7(6)9(11)13/h2,6-7H,3-4H2,1H3,(H,14,15) |
| InChIKey | XIPQGHIWOZHRPQ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|