C14H21N3O2S — CID 103074104
5-(2,2-dimethylmorpholin-4-yl)-2-[2-(sulfanylmethyl)prop-2-enyl]pyridazin-3-one (PubChem CID 103074104) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 5-(2,2-dimethylmorpholin-4-yl)-2-[2-(sulfanylmethyl)prop-2-enyl]pyridazin-3-one.
| Compound Name | 5-(2,2-dimethylmorpholin-4-yl)-2-[2-(sulfanylmethyl)prop-2-enyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103074104 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 5-(2,2-dimethylmorpholin-4-yl)-2-[2-(sulfanylmethyl)prop-2-enyl]pyridazin-3-one |
| SMILES | C=C(CS)Cn1ncc(N2CCOC(C)(C)C2)cc1=O |
| InChI | InChI=1S/C14H21N3O2S/c1-11(9-20)8-17-13(18)6-12(7-15-17)16-4-5-19-14(2,3)10-16/h6-7,20H,1,4-5,8-10H2,2-3H3 |
| InChIKey | SKJQQEWPHYMZMC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 47.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|