C8H17NO — CID 103074358
2-(methoxymethyl)-N-propan-2-ylprop-2-en-1-amine (PubChem CID 103074358) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-(methoxymethyl)-N-propan-2-ylprop-2-en-1-amine.
| Compound Name | 2-(methoxymethyl)-N-propan-2-ylprop-2-en-1-amine |
|---|---|
| PubChem CID | 103074358 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-(methoxymethyl)-N-propan-2-ylprop-2-en-1-amine |
| SMILES | C=C(CNC(C)C)COC |
| InChI | InChI=1S/C8H17NO/c1-7(2)9-5-8(3)6-10-4/h7,9H,3,5-6H2,1-2,4H3 |
| InChIKey | FTCUBWSOGBVWDK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|