C9H14F5NO — CID 103074928
N-ethyl-2-(2,2,3,3,3-pentafluoropropoxymethyl)prop-2-en-1-amine (PubChem CID 103074928) has the molecular formula C9H14F5NO and a molecular weight of 247.21 g/mol. Its IUPAC name is N-ethyl-2-(2,2,3,3,3-pentafluoropropoxymethyl)prop-2-en-1-amine.
| Compound Name | N-ethyl-2-(2,2,3,3,3-pentafluoropropoxymethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 103074928 |
| Molecular Formula | C9H14F5NO |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N-ethyl-2-(2,2,3,3,3-pentafluoropropoxymethyl)prop-2-en-1-amine |
| SMILES | C=C(CNCC)COCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H14F5NO/c1-3-15-4-7(2)5-16-6-8(10,11)9(12,13)14/h15H,2-6H2,1H3 |
| InChIKey | GHHBBKPFSDXTPG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|