C8H12F5NO — CID 103074935
N-methyl-2-(2,2,3,3,3-pentafluoropropoxymethyl)prop-2-en-1-amine (PubChem CID 103074935) has the molecular formula C8H12F5NO and a molecular weight of 233.18 g/mol. Its IUPAC name is N-methyl-2-(2,2,3,3,3-pentafluoropropoxymethyl)prop-2-en-1-amine.
| Compound Name | N-methyl-2-(2,2,3,3,3-pentafluoropropoxymethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 103074935 |
| Molecular Formula | C8H12F5NO |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | N-methyl-2-(2,2,3,3,3-pentafluoropropoxymethyl)prop-2-en-1-amine |
| SMILES | C=C(CNC)COCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H12F5NO/c1-6(3-14-2)4-15-5-7(9,10)8(11,12)13/h14H,1,3-5H2,2H3 |
| InChIKey | ZMXIUOCIVKNSGQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|