C8H15F2NO — CID 103075025
2-(2,2-difluoroethoxymethyl)-N-ethylprop-2-en-1-amine (PubChem CID 103075025) has the molecular formula C8H15F2NO and a molecular weight of 179.21 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxymethyl)-N-ethylprop-2-en-1-amine.
| Compound Name | 2-(2,2-difluoroethoxymethyl)-N-ethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 103075025 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 2-(2,2-difluoroethoxymethyl)-N-ethylprop-2-en-1-amine |
| SMILES | C=C(CNCC)COCC(F)F |
| InChI | InChI=1S/C8H15F2NO/c1-3-11-4-7(2)5-12-6-8(9)10/h8,11H,2-6H2,1H3 |
| InChIKey | AVYMMLOILRGNKU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|