C11H17F6NO — CID 103075211
N-tert-butyl-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)prop-2-en-1-amine (PubChem CID 103075211) has the molecular formula C11H17F6NO and a molecular weight of 293.25 g/mol. Its IUPAC name is N-tert-butyl-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)prop-2-en-1-amine.
| Compound Name | N-tert-butyl-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 103075211 |
| Molecular Formula | C11H17F6NO |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-tert-butyl-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)prop-2-en-1-amine |
| SMILES | C=C(CNC(C)(C)C)COC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H17F6NO/c1-7(5-18-9(2,3)4)6-19-8(10(12,13)14)11(15,16)17/h8,18H,1,5-6H2,2-4H3 |
| InChIKey | XSQLEXASHKSLPZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|