C14H17N3O3 — CID 103075541
6-[[(2-oxopiperidin-3-yl)amino]methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 103075541) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 6-[[(2-oxopiperidin-3-yl)amino]methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[[(2-oxopiperidin-3-yl)amino]methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 103075541 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 6-[[(2-oxopiperidin-3-yl)amino]methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(CNC3CCCNC3=O)cc2N1 |
| InChI | InChI=1S/C14H17N3O3/c18-13-8-20-12-4-3-9(6-11(12)17-13)7-16-10-2-1-5-15-14(10)19/h3-4,6,10,16H,1-2,5,7-8H2,(H,15,19)(H,17,18) |
| InChIKey | STMAIOOOCXYUQX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |