C25H26ClN3O3 — CID 1030764
N-benzyl-N-[3-[4-(2-chlorophenyl)piperazin-1-yl]-3-oxopropyl]furan-3-carboxamide (PubChem CID 1030764) has the molecular formula C25H26ClN3O3 and a molecular weight of 451.95 g/mol. Its IUPAC name is N-benzyl-N-[3-[4-(2-chlorophenyl)piperazin-1-yl]-3-oxopropyl]furan-3-carboxamide.
| Compound Name | N-benzyl-N-[3-[4-(2-chlorophenyl)piperazin-1-yl]-3-oxopropyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 1030764 |
| Molecular Formula | C25H26ClN3O3 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | N-benzyl-N-[3-[4-(2-chlorophenyl)piperazin-1-yl]-3-oxopropyl]furan-3-carboxamide |
| SMILES | O=C(CCN(Cc1ccccc1)C(=O)c1ccoc1)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C25H26ClN3O3/c26-22-8-4-5-9-23(22)27-13-15-28(16-14-27)24(30)10-12-29(18-20-6-2-1-3-7-20)25(31)21-11-17-32-19-21/h1-9,11,17,19H,10,12-16,18H2 |
| InChIKey | OIJUYPIGTCBGJJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |