C17H28N3O3+ — CID 7482407
N-[3-(4-ethylpiperazin-4-ium-1-yl)-3-oxopropyl]-N-propylfuran-3-carboxamide (PubChem CID 7482407) has the molecular formula C17H28N3O3+ and a molecular weight of 322.43 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-4-ium-1-yl)-3-oxopropyl]-N-propylfuran-3-carboxamide.
| Compound Name | N-[3-(4-ethylpiperazin-4-ium-1-yl)-3-oxopropyl]-N-propylfuran-3-carboxamide |
|---|---|
| PubChem CID | 7482407 |
| Molecular Formula | C17H28N3O3+ |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | N-[3-(4-ethylpiperazin-4-ium-1-yl)-3-oxopropyl]-N-propylfuran-3-carboxamide |
| SMILES | CCCN(CCC(=O)N1CC[NH+](CC)CC1)C(=O)c1ccoc1 |
| InChI | InChI=1S/C17H27N3O3/c1-3-7-20(17(22)15-6-13-23-14-15)8-5-16(21)19-11-9-18(4-2)10-12-19/h6,13-14H,3-5,7-12H2,1-2H3/p+1 |
| InChIKey | WWZBCBWBKSYSLR-UHFFFAOYSA-O |
| XLogP | 0.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |