C12H21N5O2 — CID 103077884
ethyl 4-[(4-amino-1-methylpyrazol-3-yl)amino]piperidine-1-carboxylate (PubChem CID 103077884) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is ethyl 4-[(4-amino-1-methylpyrazol-3-yl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(4-amino-1-methylpyrazol-3-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103077884 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | ethyl 4-[(4-amino-1-methylpyrazol-3-yl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2nn(C)cc2N)CC1 |
| InChI | InChI=1S/C12H21N5O2/c1-3-19-12(18)17-6-4-9(5-7-17)14-11-10(13)8-16(2)15-11/h8-9H,3-7,13H2,1-2H3,(H,14,15) |
| InChIKey | YPZGBRWCDJTDMF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |