C11H21N5 — CID 103078216
3-N-(1-ethylpiperidin-3-yl)-1-methylpyrazole-3,4-diamine (PubChem CID 103078216) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-N-(1-ethylpiperidin-3-yl)-1-methylpyrazole-3,4-diamine.
| Compound Name | 3-N-(1-ethylpiperidin-3-yl)-1-methylpyrazole-3,4-diamine |
|---|---|
| PubChem CID | 103078216 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 3-N-(1-ethylpiperidin-3-yl)-1-methylpyrazole-3,4-diamine |
| SMILES | CCN1CCCC(Nc2nn(C)cc2N)C1 |
| InChI | InChI=1S/C11H21N5/c1-3-16-6-4-5-9(7-16)13-11-10(12)8-15(2)14-11/h8-9H,3-7,12H2,1-2H3,(H,13,14) |
| InChIKey | NEUNAZPTYBPCDU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |