C8H13N3O — CID 103079090
3-(cyclopropylmethoxy)-1-methylpyrazol-4-amine (PubChem CID 103079090) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-1-methylpyrazol-4-amine.
| Compound Name | 3-(cyclopropylmethoxy)-1-methylpyrazol-4-amine |
|---|---|
| PubChem CID | 103079090 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 3-(cyclopropylmethoxy)-1-methylpyrazol-4-amine |
| SMILES | Cn1cc(N)c(OCC2CC2)n1 |
| InChI | InChI=1S/C8H13N3O/c1-11-4-7(9)8(10-11)12-5-6-2-3-6/h4,6H,2-3,5,9H2,1H3 |
| InChIKey | KWOLHIBZOQSGAY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |