C14H15F3N4O — CID 144632594
4-(cyclopropylmethoxy)-2-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]pyrimidine (PubChem CID 144632594) has the molecular formula C14H15F3N4O and a molecular weight of 312.30 g/mol. Its IUPAC name is 4-(cyclopropylmethoxy)-2-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]pyrimidine.
| Compound Name | 4-(cyclopropylmethoxy)-2-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]pyrimidine |
|---|---|
| PubChem CID | 144632594 |
| Molecular Formula | C14H15F3N4O |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 4-(cyclopropylmethoxy)-2-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]pyrimidine |
| SMILES | Cc1ncc(-c2cn(C)nc2C(F)(F)F)c(OCC2CC2)n1 |
| InChI | InChI=1S/C14H15F3N4O/c1-8-18-5-10(13(19-8)22-7-9-3-4-9)11-6-21(2)20-12(11)14(15,16)17/h5-6,9H,3-4,7H2,1-2H3 |
| InChIKey | ZUPABRQOWFLORL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |