C11H11Br2N3O2 — CID 103079192
3-(2,5-dibromo-4-methoxyphenoxy)-1-methylpyrazol-4-amine (PubChem CID 103079192) has the molecular formula C11H11Br2N3O2 and a molecular weight of 377.04 g/mol. Its IUPAC name is 3-(2,5-dibromo-4-methoxyphenoxy)-1-methylpyrazol-4-amine.
| Compound Name | 3-(2,5-dibromo-4-methoxyphenoxy)-1-methylpyrazol-4-amine |
|---|---|
| PubChem CID | 103079192 |
| Molecular Formula | C11H11Br2N3O2 |
| Molecular Weight | 377.04 g/mol |
| Exact Mass | 374.92 |
| IUPAC Name | 3-(2,5-dibromo-4-methoxyphenoxy)-1-methylpyrazol-4-amine |
| SMILES | COc1cc(Br)c(Oc2nn(C)cc2N)cc1Br |
| InChI | InChI=1S/C11H11Br2N3O2/c1-16-5-8(14)11(15-16)18-10-4-6(12)9(17-2)3-7(10)13/h3-5H,14H2,1-2H3 |
| InChIKey | MOHYCGNYEPMJIY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.04 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |