C7H11NO6 — CID 10307945
2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid (PubChem CID 10307945) has the molecular formula C7H11NO6 and a molecular weight of 205.17 g/mol. Its IUPAC name is 2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid.
| Compound Name | 2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 10307945 |
| Molecular Formula | C7H11NO6 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)CC(=O)OCC(=O)O |
| InChI | InChI=1S/C7H11NO6/c1-8(2-5(9)10)3-7(13)14-4-6(11)12/h2-4H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | DEZDRWNKDNFBIH-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |