2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid

C7H11NO6 — CID 10307945

IUPAC2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid
SMILESCN(CC(=O)O)CC(=O)OCC(=O)O
InChIInChI=1S/C7H11NO6/c1-8(2-5(9)10)3-7(13)14-4-6(11)12/h2-4H2,1H3,(H,9,10)(H,11,12)
InChIKeyDEZDRWNKDNFBIH-UHFFFAOYSA-N
MW205.17 g/mol
LogP-1.37
Rot. Bonds6

About 2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid

2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid (PubChem CID 10307945) has the molecular formula C7H11NO6 and a molecular weight of 205.17 g/mol. Its IUPAC name is 2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid.

Molecular Properties

Compound Name2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid
PubChem CID10307945
Molecular FormulaC7H11NO6
Molecular Weight205.17 g/mol
Exact Mass205.06
IUPAC Name2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid
SMILESCN(CC(=O)O)CC(=O)OCC(=O)O
InChIInChI=1S/C7H11NO6/c1-8(2-5(9)10)3-7(13)14-4-6(11)12/h2-4H2,1H3,(H,9,10)(H,11,12)
InChIKeyDEZDRWNKDNFBIH-UHFFFAOYSA-N
XLogP-1.37
TPSA104.14 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.17
LogP ≤ 5-1.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[2-(Dimethylamino)ethoxy]acetic acid
CID 13211396
[2-(Diethylamino)-2-oxoethoxy]acetic acid
CID 7320778
[2-(Dimethylamino)-2-oxoethoxy]acetic acid
CID 24214097
N,N-Bis[2-(carboxymethoxy)ethyl]glycine
CID 71357064
2,2'-((2-(2-Hydroxyethoxy)ethyl)azanediyl)diacetic acid
CID 11063985
Methyl 2-methoxy-2-morpholinoacetate
CID 12884742
O-carboxymethyl choline bromide
CID 129729728
disodium;(2S)-2-[carboxylatomethyl(ethyl)amino]-2-(2-hydroxyethoxy)acetate
CID 90478242
2-[2-(Carboxymethoxy)ethyl-(carboxymethyl)amino]acetic acid
CID 9881152
2-[2-(Carboxymethoxy)ethylamino]acetic acid
CID 10130202
2-[2-(Carboxymethoxy)ethyl-(cyanomethyl)amino]acetic acid
CID 11310455
2-Hydroxy-2-morpholin-4-ylacetic acid
CID 12864793

Frequently Asked Questions

What is the IUPAC name of 2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid?
The IUPAC name of 2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid (CID 10307945) is 2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid.
What is the SMILES notation for 2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid?
The canonical SMILES for 2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid is CN(CC(=O)O)CC(=O)OCC(=O)O.
What is the InChIKey of 2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid?
The InChIKey is DEZDRWNKDNFBIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO6/c1-8(2-5(9)10)3-7(13)14-4-6(11)12/h2-4H2,1H3,(H,9,10)(H,11,12).
What are the key properties of 2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid?
2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid has a molecular weight of 205.17 g/mol, XLogP of -1.37, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(carboxymethoxy)-2-oxoethyl]-methylamino]acetic acid is sourced from PubChem (CID 10307945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).