C11H17F2N3O3 — CID 103081224
5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 103081224) has the molecular formula C11H17F2N3O3 and a molecular weight of 277.27 g/mol. Its IUPAC name is 5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 103081224 |
| Molecular Formula | C11H17F2N3O3 |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 5-[[2-(2,2-difluoroethoxy)ethylamino]methyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1cc(CNCCOCC(F)F)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H17F2N3O3/c1-15-6-8(10(17)16(2)11(15)18)5-14-3-4-19-7-9(12)13/h6,9,14H,3-5,7H2,1-2H3 |
| InChIKey | NAHAYEWXVMCCDX-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|