C13H18F3N3O5 — CID 88974778
N-[[1-(2,2-diethoxyethyl)-2,4-dioxopyrimidin-5-yl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 88974778) has the molecular formula C13H18F3N3O5 and a molecular weight of 353.30 g/mol. Its IUPAC name is N-[[1-(2,2-diethoxyethyl)-2,4-dioxopyrimidin-5-yl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[1-(2,2-diethoxyethyl)-2,4-dioxopyrimidin-5-yl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 88974778 |
| Molecular Formula | C13H18F3N3O5 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-[[1-(2,2-diethoxyethyl)-2,4-dioxopyrimidin-5-yl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | CCOC(Cn1cc(CNC(=O)C(F)(F)F)c(=O)[nH]c1=O)OCC |
| InChI | InChI=1S/C13H18F3N3O5/c1-3-23-9(24-4-2)7-19-6-8(10(20)18-12(19)22)5-17-11(21)13(14,15)16/h6,9H,3-5,7H2,1-2H3,(H,17,21)(H,18,20,22) |
| InChIKey | FKDCNKMLSPBQSB-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|