C11H14F2N2O4 — CID 103081344
N-[2-(2,2-difluoroethoxy)ethyl]-3-methoxy-2-nitroaniline (PubChem CID 103081344) has the molecular formula C11H14F2N2O4 and a molecular weight of 276.24 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-3-methoxy-2-nitroaniline.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-3-methoxy-2-nitroaniline |
|---|---|
| PubChem CID | 103081344 |
| Molecular Formula | C11H14F2N2O4 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-3-methoxy-2-nitroaniline |
| SMILES | COc1cccc(NCCOCC(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14F2N2O4/c1-18-9-4-2-3-8(11(9)15(16)17)14-5-6-19-7-10(12)13/h2-4,10,14H,5-7H2,1H3 |
| InChIKey | NZNWNPINTDICEC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|