C11H21F2NO — CID 103082660
1-cyclobutyl-N-[2-(2,2-difluoroethoxy)ethyl]propan-2-amine (PubChem CID 103082660) has the molecular formula C11H21F2NO and a molecular weight of 221.29 g/mol. Its IUPAC name is 1-cyclobutyl-N-[2-(2,2-difluoroethoxy)ethyl]propan-2-amine.
| Compound Name | 1-cyclobutyl-N-[2-(2,2-difluoroethoxy)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 103082660 |
| Molecular Formula | C11H21F2NO |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 1-cyclobutyl-N-[2-(2,2-difluoroethoxy)ethyl]propan-2-amine |
| SMILES | CC(CC1CCC1)NCCOCC(F)F |
| InChI | InChI=1S/C11H21F2NO/c1-9(7-10-3-2-4-10)14-5-6-15-8-11(12)13/h9-11,14H,2-8H2,1H3 |
| InChIKey | BEQGLDUDJDAUPW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|