C9H11F2N3O3 — CID 103082670
N-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 103082670) has the molecular formula C9H11F2N3O3 and a molecular weight of 247.20 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 103082670 |
| Molecular Formula | C9H11F2N3O3 |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NCCOCC(F)F)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C9H11F2N3O3/c10-7(11)5-17-4-3-12-9(16)6-1-2-8(15)14-13-6/h1-2,7H,3-5H2,(H,12,16)(H,14,15) |
| InChIKey | ORKOZLRBZJAAKD-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|