C17H23NO2 — CID 103082873
3-methoxy-N-[1-(3-methyl-1-benzofuran-2-yl)ethyl]cyclopentan-1-amine (PubChem CID 103082873) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-methoxy-N-[1-(3-methyl-1-benzofuran-2-yl)ethyl]cyclopentan-1-amine.
| Compound Name | 3-methoxy-N-[1-(3-methyl-1-benzofuran-2-yl)ethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 103082873 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3-methoxy-N-[1-(3-methyl-1-benzofuran-2-yl)ethyl]cyclopentan-1-amine |
| SMILES | COC1CCC(NC(C)c2oc3ccccc3c2C)C1 |
| InChI | InChI=1S/C17H23NO2/c1-11-15-6-4-5-7-16(15)20-17(11)12(2)18-13-8-9-14(10-13)19-3/h4-7,12-14,18H,8-10H2,1-3H3 |
| InChIKey | YJRYGWSVIYITIE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |