C16H21NO4S — CID 119039497
2-methyl-N-[1-(3-methyl-1-benzofuran-2-yl)ethyl]oxolane-3-sulfonamide (PubChem CID 119039497) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is 2-methyl-N-[1-(3-methyl-1-benzofuran-2-yl)ethyl]oxolane-3-sulfonamide.
| Compound Name | 2-methyl-N-[1-(3-methyl-1-benzofuran-2-yl)ethyl]oxolane-3-sulfonamide |
|---|---|
| PubChem CID | 119039497 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-methyl-N-[1-(3-methyl-1-benzofuran-2-yl)ethyl]oxolane-3-sulfonamide |
| SMILES | Cc1c(C(C)NS(=O)(=O)C2CCOC2C)oc2ccccc12 |
| InChI | InChI=1S/C16H21NO4S/c1-10-13-6-4-5-7-14(13)21-16(10)11(2)17-22(18,19)15-8-9-20-12(15)3/h4-7,11-12,15,17H,8-9H2,1-3H3 |
| InChIKey | ZDZRVRFMUJEIDO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |