C16H23NO2 — CID 103082978
6-methoxy-N-(3-methoxycyclopentyl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 103082978) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 6-methoxy-N-(3-methoxycyclopentyl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 6-methoxy-N-(3-methoxycyclopentyl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 103082978 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 6-methoxy-N-(3-methoxycyclopentyl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | COc1ccc2c(c1)C(NC1CCC(OC)C1)CC2 |
| InChI | InChI=1S/C16H23NO2/c1-18-13-7-5-12(9-13)17-16-8-4-11-3-6-14(19-2)10-15(11)16/h3,6,10,12-13,16-17H,4-5,7-9H2,1-2H3 |
| InChIKey | HCVCTYPPBDTBIU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |