C14H16O7 — CID 10308371
6-[(4,5-dioxopyran-2-yl)methoxy]-2-ethenyl-6-oxohexanoic acid (PubChem CID 10308371) has the molecular formula C14H16O7 and a molecular weight of 296.28 g/mol. Its IUPAC name is 6-[(4,5-dioxopyran-2-yl)methoxy]-2-ethenyl-6-oxohexanoic acid.
| Compound Name | 6-[(4,5-dioxopyran-2-yl)methoxy]-2-ethenyl-6-oxohexanoic acid |
|---|---|
| PubChem CID | 10308371 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 6-[(4,5-dioxopyran-2-yl)methoxy]-2-ethenyl-6-oxohexanoic acid |
| SMILES | C=CC(CCCC(=O)OCC1=CC(=O)C(=O)CO1)C(=O)O |
| InChI | InChI=1S/C14H16O7/c1-2-9(14(18)19)4-3-5-13(17)21-7-10-6-11(15)12(16)8-20-10/h2,6,9H,1,3-5,7-8H2,(H,18,19) |
| InChIKey | GQNUJYVRXDEAIO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|