C13H19N5O2S — CID 103084961
N-[1-[1-(4-methylsulfonylphenyl)tetrazol-5-yl]ethyl]propan-1-amine (PubChem CID 103084961) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is N-[1-[1-(4-methylsulfonylphenyl)tetrazol-5-yl]ethyl]propan-1-amine.
| Compound Name | N-[1-[1-(4-methylsulfonylphenyl)tetrazol-5-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 103084961 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[1-[1-(4-methylsulfonylphenyl)tetrazol-5-yl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1nnnn1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H19N5O2S/c1-4-9-14-10(2)13-15-16-17-18(13)11-5-7-12(8-6-11)21(3,19)20/h5-8,10,14H,4,9H2,1-3H3 |
| InChIKey | DUCHECHILRHIRC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |