C13H21NO4S2 — CID 64675887
1-(4-methylsulfonylphenyl)sulfonyl-N-propylpropan-2-amine (PubChem CID 64675887) has the molecular formula C13H21NO4S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-(4-methylsulfonylphenyl)sulfonyl-N-propylpropan-2-amine.
| Compound Name | 1-(4-methylsulfonylphenyl)sulfonyl-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 64675887 |
| Molecular Formula | C13H21NO4S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 1-(4-methylsulfonylphenyl)sulfonyl-N-propylpropan-2-amine |
| SMILES | CCCNC(C)CS(=O)(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H21NO4S2/c1-4-9-14-11(2)10-20(17,18)13-7-5-12(6-8-13)19(3,15)16/h5-8,11,14H,4,9-10H2,1-3H3 |
| InChIKey | KNBYJVVFROPZSK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |