C15H23N5O — CID 103085288
N-[1-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]ethyl]-2-methylpropan-1-amine (PubChem CID 103085288) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[1-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]ethyl]-2-methylpropan-1-amine.
| Compound Name | N-[1-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]ethyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 103085288 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | N-[1-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]ethyl]-2-methylpropan-1-amine |
| SMILES | COc1ccc(Cn2nnnc2C(C)NCC(C)C)cc1 |
| InChI | InChI=1S/C15H23N5O/c1-11(2)9-16-12(3)15-17-18-19-20(15)10-13-5-7-14(21-4)8-6-13/h5-8,11-12,16H,9-10H2,1-4H3 |
| InChIKey | UBIMFERIGXCHNS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |