C10H19N5 — CID 103086374
1-[1-(2,3-dimethylcyclopentyl)tetrazol-5-yl]ethanamine (PubChem CID 103086374) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is 1-[1-(2,3-dimethylcyclopentyl)tetrazol-5-yl]ethanamine.
| Compound Name | 1-[1-(2,3-dimethylcyclopentyl)tetrazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 103086374 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 1-[1-(2,3-dimethylcyclopentyl)tetrazol-5-yl]ethanamine |
| SMILES | CC(N)c1nnnn1C1CCC(C)C1C |
| InChI | InChI=1S/C10H19N5/c1-6-4-5-9(7(6)2)15-10(8(3)11)12-13-14-15/h6-9H,4-5,11H2,1-3H3 |
| InChIKey | RPUFFKBMHVEILM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |