C9H15IN4 — CID 71425658
1-(2,3-dimethylcyclohexyl)-5-iodotetrazole (PubChem CID 71425658) has the molecular formula C9H15IN4 and a molecular weight of 306.15 g/mol. Its IUPAC name is 1-(2,3-dimethylcyclohexyl)-5-iodotetrazole.
| Compound Name | 1-(2,3-dimethylcyclohexyl)-5-iodotetrazole |
|---|---|
| PubChem CID | 71425658 |
| Molecular Formula | C9H15IN4 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 1-(2,3-dimethylcyclohexyl)-5-iodotetrazole |
| SMILES | CC1CCCC(n2nnnc2I)C1C |
| InChI | InChI=1S/C9H15IN4/c1-6-4-3-5-8(7(6)2)14-9(10)11-12-13-14/h6-8H,3-5H2,1-2H3 |
| InChIKey | PFUKTQRIGUKTBD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|