C11H23N5O3S — CID 103086514
N-(2-methoxyethyl)-1-[1-(2-methyl-2-methylsulfonylpropyl)tetrazol-5-yl]ethanamine (PubChem CID 103086514) has the molecular formula C11H23N5O3S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-[1-(2-methyl-2-methylsulfonylpropyl)tetrazol-5-yl]ethanamine.
| Compound Name | N-(2-methoxyethyl)-1-[1-(2-methyl-2-methylsulfonylpropyl)tetrazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 103086514 |
| Molecular Formula | C11H23N5O3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | N-(2-methoxyethyl)-1-[1-(2-methyl-2-methylsulfonylpropyl)tetrazol-5-yl]ethanamine |
| SMILES | COCCNC(C)c1nnnn1CC(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H23N5O3S/c1-9(12-6-7-19-4)10-13-14-15-16(10)8-11(2,3)20(5,17)18/h9,12H,6-8H2,1-5H3 |
| InChIKey | JEHMMEVUEUWFCM-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|