C13H25N5O — CID 103086509
N-(2-methoxyethyl)-1-[1-(2,2,3,3-tetramethylcyclopropyl)tetrazol-5-yl]ethanamine (PubChem CID 103086509) has the molecular formula C13H25N5O and a molecular weight of 267.38 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-[1-(2,2,3,3-tetramethylcyclopropyl)tetrazol-5-yl]ethanamine.
| Compound Name | N-(2-methoxyethyl)-1-[1-(2,2,3,3-tetramethylcyclopropyl)tetrazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 103086509 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | N-(2-methoxyethyl)-1-[1-(2,2,3,3-tetramethylcyclopropyl)tetrazol-5-yl]ethanamine |
| SMILES | COCCNC(C)c1nnnn1C1C(C)(C)C1(C)C |
| InChI | InChI=1S/C13H25N5O/c1-9(14-7-8-19-6)10-15-16-17-18(10)11-12(2,3)13(11,4)5/h9,11,14H,7-8H2,1-6H3 |
| InChIKey | VRVKNRZKDATYJT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|