C11H21N5O3S — CID 103086214
1-[1-(1,1-dioxothian-3-yl)tetrazol-5-yl]-N-(2-methoxyethyl)ethanamine (PubChem CID 103086214) has the molecular formula C11H21N5O3S and a molecular weight of 303.39 g/mol. Its IUPAC name is 1-[1-(1,1-dioxothian-3-yl)tetrazol-5-yl]-N-(2-methoxyethyl)ethanamine.
| Compound Name | 1-[1-(1,1-dioxothian-3-yl)tetrazol-5-yl]-N-(2-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 103086214 |
| Molecular Formula | C11H21N5O3S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1-[1-(1,1-dioxothian-3-yl)tetrazol-5-yl]-N-(2-methoxyethyl)ethanamine |
| SMILES | COCCNC(C)c1nnnn1C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H21N5O3S/c1-9(12-5-6-19-2)11-13-14-15-16(11)10-4-3-7-20(17,18)8-10/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | CRENYNDYGPZTSD-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|