C10H19N5O2S — CID 63918280
N-[[1-(1,1-dioxothian-3-yl)tetrazol-5-yl]methyl]propan-1-amine (PubChem CID 63918280) has the molecular formula C10H19N5O2S and a molecular weight of 273.36 g/mol. Its IUPAC name is N-[[1-(1,1-dioxothian-3-yl)tetrazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(1,1-dioxothian-3-yl)tetrazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63918280 |
| Molecular Formula | C10H19N5O2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-[[1-(1,1-dioxothian-3-yl)tetrazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1nnnn1C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19N5O2S/c1-2-5-11-7-10-12-13-14-15(10)9-4-3-6-18(16,17)8-9/h9,11H,2-8H2,1H3 |
| InChIKey | FJDWXNQJDWCCIK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|