C12H18F3N3O2S — CID 66441292
N-[[1-(1,1-dioxothiolan-3-yl)-5-(trifluoromethyl)pyrazol-4-yl]methyl]propan-1-amine (PubChem CID 66441292) has the molecular formula C12H18F3N3O2S and a molecular weight of 325.36 g/mol. Its IUPAC name is N-[[1-(1,1-dioxothiolan-3-yl)-5-(trifluoromethyl)pyrazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(1,1-dioxothiolan-3-yl)-5-(trifluoromethyl)pyrazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66441292 |
| Molecular Formula | C12H18F3N3O2S |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[[1-(1,1-dioxothiolan-3-yl)-5-(trifluoromethyl)pyrazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnn(C2CCS(=O)(=O)C2)c1C(F)(F)F |
| InChI | InChI=1S/C12H18F3N3O2S/c1-2-4-16-6-9-7-17-18(11(9)12(13,14)15)10-3-5-21(19,20)8-10/h7,10,16H,2-6,8H2,1H3 |
| InChIKey | TYCRSQKBLYDQOO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|