C12H21N3O3S — CID 66440486
N-[[1-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-4-yl]methyl]-2-methoxyethanamine (PubChem CID 66440486) has the molecular formula C12H21N3O3S and a molecular weight of 287.39 g/mol. Its IUPAC name is N-[[1-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-4-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-4-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 66440486 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-[[1-(1,1-dioxothiolan-3-yl)-5-methylpyrazol-4-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cnn(C2CCS(=O)(=O)C2)c1C |
| InChI | InChI=1S/C12H21N3O3S/c1-10-11(7-13-4-5-18-2)8-14-15(10)12-3-6-19(16,17)9-12/h8,12-13H,3-7,9H2,1-2H3 |
| InChIKey | DNAXMUCUTQKPFD-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|