C12H19N3O4S — CID 94237847
1-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-methoxyethyl)-5-methylpyrazole-4-carboxamide (PubChem CID 94237847) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-methoxyethyl)-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-methoxyethyl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 94237847 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-methoxyethyl)-5-methylpyrazole-4-carboxamide |
| SMILES | COCCNC(=O)c1cnn([C@H]2CCS(=O)(=O)C2)c1C |
| InChI | InChI=1S/C12H19N3O4S/c1-9-11(12(16)13-4-5-19-2)7-14-15(9)10-3-6-20(17,18)8-10/h7,10H,3-6,8H2,1-2H3,(H,13,16)/t10-/m0/s1 |
| InChIKey | SIERBMQKZPKPKA-JTQLQIEISA-N |
| XLogP | -0.07 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|