C14H24N4O3S — CID 110383613
N-[3-(dimethylamino)propyl]-1-(1,1-dioxothiolan-3-yl)-5-methylpyrazole-4-carboxamide (PubChem CID 110383613) has the molecular formula C14H24N4O3S and a molecular weight of 328.44 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-1-(1,1-dioxothiolan-3-yl)-5-methylpyrazole-4-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-1-(1,1-dioxothiolan-3-yl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 110383613 |
| Molecular Formula | C14H24N4O3S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-1-(1,1-dioxothiolan-3-yl)-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCCN(C)C)cnn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H24N4O3S/c1-11-13(14(19)15-6-4-7-17(2)3)9-16-18(11)12-5-8-22(20,21)10-12/h9,12H,4-8,10H2,1-3H3,(H,15,19) |
| InChIKey | IJSYJCOWQMTXAW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|