C14H23N3O3S — CID 110390778
1-(1,1-dioxothiolan-3-yl)-5-methyl-N-pentylpyrazole-3-carboxamide (PubChem CID 110390778) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-5-methyl-N-pentylpyrazole-3-carboxamide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-5-methyl-N-pentylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110390778 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-5-methyl-N-pentylpyrazole-3-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(C)n(C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C14H23N3O3S/c1-3-4-5-7-15-14(18)13-9-11(2)17(16-13)12-6-8-21(19,20)10-12/h9,12H,3-8,10H2,1-2H3,(H,15,18) |
| InChIKey | LYJLLSOFBQYGCK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|