C12H15BrClN — CID 103092890
(E)-4-(3-bromo-4-chlorophenyl)-N,3-dimethylbut-3-en-2-amine (PubChem CID 103092890) has the molecular formula C12H15BrClN and a molecular weight of 288.62 g/mol. Its IUPAC name is (E)-4-(3-bromo-4-chlorophenyl)-N,3-dimethylbut-3-en-2-amine.
| Compound Name | (E)-4-(3-bromo-4-chlorophenyl)-N,3-dimethylbut-3-en-2-amine |
|---|---|
| PubChem CID | 103092890 |
| Molecular Formula | C12H15BrClN |
| Molecular Weight | 288.62 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | (E)-4-(3-bromo-4-chlorophenyl)-N,3-dimethylbut-3-en-2-amine |
| SMILES | CNC(C)/C(C)=C/c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C12H15BrClN/c1-8(9(2)15-3)6-10-4-5-12(14)11(13)7-10/h4-7,9,15H,1-3H3/b8-6+ |
| InChIKey | SYUMRFFCSBYVCK-SOFGYWHQSA-N |
| XLogP | 4.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |