C15H21ClN2O3 — CID 103092894
2-[2-chloro-6-methoxy-4-[(E)-2-methyl-3-(methylamino)but-1-enyl]phenoxy]acetamide (PubChem CID 103092894) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 2-[2-chloro-6-methoxy-4-[(E)-2-methyl-3-(methylamino)but-1-enyl]phenoxy]acetamide.
| Compound Name | 2-[2-chloro-6-methoxy-4-[(E)-2-methyl-3-(methylamino)but-1-enyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 103092894 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-[2-chloro-6-methoxy-4-[(E)-2-methyl-3-(methylamino)but-1-enyl]phenoxy]acetamide |
| SMILES | CNC(C)/C(C)=C/c1cc(Cl)c(OCC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-9(10(2)18-3)5-11-6-12(16)15(13(7-11)20-4)21-8-14(17)19/h5-7,10,18H,8H2,1-4H3,(H2,17,19)/b9-5+ |
| InChIKey | YWYJQHUQXCXNIN-WEVVVXLNSA-N |
| XLogP | 2.22 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |