About (E)-4-(3-chloro-4,5-dimethoxyphenyl)-N-ethyl-3-methylbut-3-en-2-amine
(E)-4-(3-chloro-4,5-dimethoxyphenyl)-N-ethyl-3-methylbut-3-en-2-amine (PubChem CID 103093259) has the molecular formula C15H22ClNO2
and a molecular weight of 283.80 g/mol. Its IUPAC name is (E)-4-(3-chloro-4,5-dimethoxyphenyl)-N-ethyl-3-methylbut-3-en-2-amine.
Molecular Properties
| Compound Name | (E)-4-(3-chloro-4,5-dimethoxyphenyl)-N-ethyl-3-methylbut-3-en-2-amine |
| PubChem CID | 103093259 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | (E)-4-(3-chloro-4,5-dimethoxyphenyl)-N-ethyl-3-methylbut-3-en-2-amine |
| SMILES | CCNC(C)/C(C)=C/c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H22ClNO2/c1-6-17-11(3)10(2)7-12-8-13(16)15(19-5)14(9-12)18-4/h7-9,11,17H,6H2,1-5H3/b10-7+ |
| InChIKey | AZMGOMHLUYNTSR-JXMROGBWSA-N |
| XLogP | 3.76 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-4-(3-chloro-4,5-dimethoxyphenyl)-N-ethyl-3-methylbut-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(3-chloro-4,5-dimethoxyphenyl)-N-ethyl-3-methylbut-3-en-2-amine?
The IUPAC name of (E)-4-(3-chloro-4,5-dimethoxyphenyl)-N-ethyl-3-methylbut-3-en-2-amine (CID 103093259) is (E)-4-(3-chloro-4,5-dimethoxyphenyl)-N-ethyl-3-methylbut-3-en-2-amine.
What is the SMILES notation for (E)-4-(3-chloro-4,5-dimethoxyphenyl)-N-ethyl-3-methylbut-3-en-2-amine?
The canonical SMILES for (E)-4-(3-chloro-4,5-dimethoxyphenyl)-N-ethyl-3-methylbut-3-en-2-amine is CCNC(C)/C(C)=C/c1cc(Cl)c(OC)c(OC)c1.
What is the InChIKey of (E)-4-(3-chloro-4,5-dimethoxyphenyl)-N-ethyl-3-methylbut-3-en-2-amine?
The InChIKey is AZMGOMHLUYNTSR-JXMROGBWSA-N. The full InChI is InChI=1S/C15H22ClNO2/c1-6-17-11(3)10(2)7-12-8-13(16)15(19-5)14(9-12)18-4/h7-9,11,17H,6H2,1-5H3/b10-7+.
What are the key properties of (E)-4-(3-chloro-4,5-dimethoxyphenyl)-N-ethyl-3-methylbut-3-en-2-amine?
(E)-4-(3-chloro-4,5-dimethoxyphenyl)-N-ethyl-3-methylbut-3-en-2-amine has a molecular weight of 283.80 g/mol, XLogP of 3.76, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(3-chloro-4,5-dimethoxyphenyl)-N-ethyl-3-methylbut-3-en-2-amine is sourced from PubChem (CID 103093259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).