C17H22N2 — CID 103093597
(E)-3-methyl-N-propyl-4-quinolin-2-ylbut-3-en-2-amine (PubChem CID 103093597) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (E)-3-methyl-N-propyl-4-quinolin-2-ylbut-3-en-2-amine.
| Compound Name | (E)-3-methyl-N-propyl-4-quinolin-2-ylbut-3-en-2-amine |
|---|---|
| PubChem CID | 103093597 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (E)-3-methyl-N-propyl-4-quinolin-2-ylbut-3-en-2-amine |
| SMILES | CCCNC(C)/C(C)=C/c1ccc2ccccc2n1 |
| InChI | InChI=1S/C17H22N2/c1-4-11-18-14(3)13(2)12-16-10-9-15-7-5-6-8-17(15)19-16/h5-10,12,14,18H,4,11H2,1-3H3/b13-12+ |
| InChIKey | YMJPBFFVHQEVKD-OUKQBFOZSA-N |
| XLogP | 4.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |