C17H21BrN2 — CID 103093776
(E)-4-(5-bromoquinolin-8-yl)-3-methyl-N-propylbut-3-en-2-amine (PubChem CID 103093776) has the molecular formula C17H21BrN2 and a molecular weight of 333.27 g/mol. Its IUPAC name is (E)-4-(5-bromoquinolin-8-yl)-3-methyl-N-propylbut-3-en-2-amine.
| Compound Name | (E)-4-(5-bromoquinolin-8-yl)-3-methyl-N-propylbut-3-en-2-amine |
|---|---|
| PubChem CID | 103093776 |
| Molecular Formula | C17H21BrN2 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | (E)-4-(5-bromoquinolin-8-yl)-3-methyl-N-propylbut-3-en-2-amine |
| SMILES | CCCNC(C)/C(C)=C/c1ccc(Br)c2cccnc12 |
| InChI | InChI=1S/C17H21BrN2/c1-4-9-19-13(3)12(2)11-14-7-8-16(18)15-6-5-10-20-17(14)15/h5-8,10-11,13,19H,4,9H2,1-3H3/b12-11+ |
| InChIKey | WUCKPGCMMUKPIZ-VAWYXSNFSA-N |
| XLogP | 4.79 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |